C12H16N2 — CID 163959689
[3-(3-methyl-2,3-dihydropyrrol-1-yl)phenyl]methanamine (PubChem CID 163959689) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is [3-(3-methyl-2,3-dihydropyrrol-1-yl)phenyl]methanamine.
| Compound Name | [3-(3-methyl-2,3-dihydropyrrol-1-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 163959689 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | [3-(3-methyl-2,3-dihydropyrrol-1-yl)phenyl]methanamine |
| SMILES | CC1C=CN(c2cccc(CN)c2)C1 |
| InChI | InChI=1S/C12H16N2/c1-10-5-6-14(9-10)12-4-2-3-11(7-12)8-13/h2-7,10H,8-9,13H2,1H3 |
| InChIKey | SGKGXPTWVABPER-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |