C10H12N2O — CID 139933677
[3-(5H-1,2-oxazol-2-yl)phenyl]methanamine (PubChem CID 139933677) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is [3-(5H-1,2-oxazol-2-yl)phenyl]methanamine.
| Compound Name | [3-(5H-1,2-oxazol-2-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 139933677 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | [3-(5H-1,2-oxazol-2-yl)phenyl]methanamine |
| SMILES | NCc1cccc(N2C=CCO2)c1 |
| InChI | InChI=1S/C10H12N2O/c11-8-9-3-1-4-10(7-9)12-5-2-6-13-12/h1-5,7H,6,8,11H2 |
| InChIKey | YYTBSTYSAHDRNL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |