C14H19NSi — CID 174773540
[4-(3,5-dimethyl-4-silylcyclopenta-1,4-dien-1-yl)phenyl]methanamine (PubChem CID 174773540) has the molecular formula C14H19NSi and a molecular weight of 229.40 g/mol. Its IUPAC name is [4-(3,5-dimethyl-4-silylcyclopenta-1,4-dien-1-yl)phenyl]methanamine.
| Compound Name | [4-(3,5-dimethyl-4-silylcyclopenta-1,4-dien-1-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 174773540 |
| Molecular Formula | C14H19NSi |
| Molecular Weight | 229.40 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | [4-(3,5-dimethyl-4-silylcyclopenta-1,4-dien-1-yl)phenyl]methanamine |
| SMILES | CC1=C([SiH3])C(C)C=C1c1ccc(CN)cc1 |
| InChI | InChI=1S/C14H19NSi/c1-9-7-13(10(2)14(9)16)12-5-3-11(8-15)4-6-12/h3-7,9H,8,15H2,1-2,16H3 |
| InChIKey | XZSBENWPPCVPPC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|