C16H23NSi — CID 174657861
[4-(2,4,5,5-tetramethyl-3-silylcyclopenta-1,3-dien-1-yl)phenyl]methanamine (PubChem CID 174657861) has the molecular formula C16H23NSi and a molecular weight of 257.45 g/mol. Its IUPAC name is [4-(2,4,5,5-tetramethyl-3-silylcyclopenta-1,3-dien-1-yl)phenyl]methanamine.
| Compound Name | [4-(2,4,5,5-tetramethyl-3-silylcyclopenta-1,3-dien-1-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 174657861 |
| Molecular Formula | C16H23NSi |
| Molecular Weight | 257.45 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | [4-(2,4,5,5-tetramethyl-3-silylcyclopenta-1,3-dien-1-yl)phenyl]methanamine |
| SMILES | CC1=C(c2ccc(CN)cc2)C(C)(C)C(C)=C1[SiH3] |
| InChI | InChI=1S/C16H23NSi/c1-10-14(16(3,4)11(2)15(10)18)13-7-5-12(9-17)6-8-13/h5-8H,9,17H2,1-4,18H3 |
| InChIKey | IOZMUGHDIFNIAO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|