C33H52Si — CID 173383793
2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl-(3,5-dihexylphenyl)-dimethylsilane (PubChem CID 173383793) has the molecular formula C33H52Si and a molecular weight of 476.87 g/mol. Its IUPAC name is 2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl-(3,5-dihexylphenyl)-dimethylsilane.
| Compound Name | 2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl-(3,5-dihexylphenyl)-dimethylsilane |
|---|---|
| PubChem CID | 173383793 |
| Molecular Formula | C33H52Si |
| Molecular Weight | 476.87 g/mol |
| Exact Mass | 476.38 |
| IUPAC Name | 2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl-(3,5-dihexylphenyl)-dimethylsilane |
| SMILES | CCCCCCc1cc(CCCCCC)cc([Si](C)(C)C2C3C=CC=CC3C3CCCCC32)c1 |
| InChI | InChI=1S/C33H52Si/c1-5-7-9-11-17-26-23-27(18-12-10-8-6-2)25-28(24-26)34(3,4)33-31-21-15-13-19-29(31)30-20-14-16-22-32(30)33/h13,15,19,21,23-25,29-33H,5-12,14,16-18,20,22H2,1-4H3 |
| InChIKey | WBLLVGOHYLSXBP-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.87 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|