C15H18BrF2N3S — CID 135222375
5-[6-(4-bromo-2,6-difluorophenyl)hexyl]-6H-1,3,4-thiadiazin-2-amine (PubChem CID 135222375) has the molecular formula C15H18BrF2N3S and a molecular weight of 390.30 g/mol. Its IUPAC name is 5-[6-(4-bromo-2,6-difluorophenyl)hexyl]-6H-1,3,4-thiadiazin-2-amine.
| Compound Name | 5-[6-(4-bromo-2,6-difluorophenyl)hexyl]-6H-1,3,4-thiadiazin-2-amine |
|---|---|
| PubChem CID | 135222375 |
| Molecular Formula | C15H18BrF2N3S |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 5-[6-(4-bromo-2,6-difluorophenyl)hexyl]-6H-1,3,4-thiadiazin-2-amine |
| SMILES | NC1=NN=C(CCCCCCc2c(F)cc(Br)cc2F)CS1 |
| InChI | InChI=1S/C15H18BrF2N3S/c16-10-7-13(17)12(14(18)8-10)6-4-2-1-3-5-11-9-22-15(19)21-20-11/h7-8H,1-6,9H2,(H2,19,21) |
| InChIKey | PETGQMNSUKAMKR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.30 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|