C18H19BrO4 — CID 15127298
2-(2-bromo-5-methoxy-3-phenylmethoxyphenyl)-1,3-dioxane (PubChem CID 15127298) has the molecular formula C18H19BrO4 and a molecular weight of 379.25 g/mol. Its IUPAC name is 2-(2-bromo-5-methoxy-3-phenylmethoxyphenyl)-1,3-dioxane.
| Compound Name | 2-(2-bromo-5-methoxy-3-phenylmethoxyphenyl)-1,3-dioxane |
|---|---|
| PubChem CID | 15127298 |
| Molecular Formula | C18H19BrO4 |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 2-(2-bromo-5-methoxy-3-phenylmethoxyphenyl)-1,3-dioxane |
| SMILES | COc1cc(OCc2ccccc2)c(Br)c(C2OCCCO2)c1 |
| InChI | InChI=1S/C18H19BrO4/c1-20-14-10-15(18-21-8-5-9-22-18)17(19)16(11-14)23-12-13-6-3-2-4-7-13/h2-4,6-7,10-11,18H,5,8-9,12H2,1H3 |
| InChIKey | LIZDTAUXTUJFJG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |