4-[2-(1,3-dioxan-2-yl)-6-phenylmethoxybenzoyl]benzoic acid

C25H22O6 — CID 11004285

IUPAC4-[2-(1,3-dioxan-2-yl)-6-phenylmethoxybenzoyl]benzoic acid
SMILESO=C(O)c1ccc(C(=O)c2c(OCc3ccccc3)cccc2C2OCCCO2)cc1
InChIInChI=1S/C25H22O6/c26-23(18-10-12-19(13-11-18)24(27)28)22-20(25-29-14-5-15-30-25)8-4-9-21(22)31-16-17-6-2-1-3-7-17/h1-4,6-13,25H,5,14-16H2,(H,27,28)
InChIKeyZBVVDCDHRWCHFF-UHFFFAOYSA-N
MW418.45 g/mol
LogP4.63
Rot. Bonds7

About 4-[2-(1,3-dioxan-2-yl)-6-phenylmethoxybenzoyl]benzoic acid

4-[2-(1,3-dioxan-2-yl)-6-phenylmethoxybenzoyl]benzoic acid (PubChem CID 11004285) has the molecular formula C25H22O6 and a molecular weight of 418.45 g/mol. Its IUPAC name is 4-[2-(1,3-dioxan-2-yl)-6-phenylmethoxybenzoyl]benzoic acid.

Molecular Properties

Compound Name4-[2-(1,3-dioxan-2-yl)-6-phenylmethoxybenzoyl]benzoic acid
PubChem CID11004285
Molecular FormulaC25H22O6
Molecular Weight418.45 g/mol
Exact Mass418.14
IUPAC Name4-[2-(1,3-dioxan-2-yl)-6-phenylmethoxybenzoyl]benzoic acid
SMILESO=C(O)c1ccc(C(=O)c2c(OCc3ccccc3)cccc2C2OCCCO2)cc1
InChIInChI=1S/C25H22O6/c26-23(18-10-12-19(13-11-18)24(27)28)22-20(25-29-14-5-15-30-25)8-4-9-21(22)31-16-17-6-2-1-3-7-17/h1-4,6-13,25H,5,14-16H2,(H,27,28)
InChIKeyZBVVDCDHRWCHFF-UHFFFAOYSA-N
XLogP4.63
TPSA82.06 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms31
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500418.45
LogP ≤ 54.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 4-[2-(1,3-dioxan-2-yl)-6-phenylmethoxybenzoyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[2-(1,3-dioxan-2-yl)-6-phenylmethoxybenzoyl]benzoic acid?
The IUPAC name of 4-[2-(1,3-dioxan-2-yl)-6-phenylmethoxybenzoyl]benzoic acid (CID 11004285) is 4-[2-(1,3-dioxan-2-yl)-6-phenylmethoxybenzoyl]benzoic acid.
What is the SMILES notation for 4-[2-(1,3-dioxan-2-yl)-6-phenylmethoxybenzoyl]benzoic acid?
The canonical SMILES for 4-[2-(1,3-dioxan-2-yl)-6-phenylmethoxybenzoyl]benzoic acid is O=C(O)c1ccc(C(=O)c2c(OCc3ccccc3)cccc2C2OCCCO2)cc1.
What is the InChIKey of 4-[2-(1,3-dioxan-2-yl)-6-phenylmethoxybenzoyl]benzoic acid?
The InChIKey is ZBVVDCDHRWCHFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22O6/c26-23(18-10-12-19(13-11-18)24(27)28)22-20(25-29-14-5-15-30-25)8-4-9-21(22)31-16-17-6-2-1-3-7-17/h1-4,6-13,25H,5,14-16H2,(H,27,28).
What are the key properties of 4-[2-(1,3-dioxan-2-yl)-6-phenylmethoxybenzoyl]benzoic acid?
4-[2-(1,3-dioxan-2-yl)-6-phenylmethoxybenzoyl]benzoic acid has a molecular weight of 418.45 g/mol, XLogP of 4.63, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1,3-dioxan-2-yl)-6-phenylmethoxybenzoyl]benzoic acid is sourced from PubChem (CID 11004285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).