C25H22O6 — CID 11004285
4-[2-(1,3-dioxan-2-yl)-6-phenylmethoxybenzoyl]benzoic acid (PubChem CID 11004285) has the molecular formula C25H22O6 and a molecular weight of 418.45 g/mol. Its IUPAC name is 4-[2-(1,3-dioxan-2-yl)-6-phenylmethoxybenzoyl]benzoic acid.
| Compound Name | 4-[2-(1,3-dioxan-2-yl)-6-phenylmethoxybenzoyl]benzoic acid |
|---|---|
| PubChem CID | 11004285 |
| Molecular Formula | C25H22O6 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 4-[2-(1,3-dioxan-2-yl)-6-phenylmethoxybenzoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(=O)c2c(OCc3ccccc3)cccc2C2OCCCO2)cc1 |
| InChI | InChI=1S/C25H22O6/c26-23(18-10-12-19(13-11-18)24(27)28)22-20(25-29-14-5-15-30-25)8-4-9-21(22)31-16-17-6-2-1-3-7-17/h1-4,6-13,25H,5,14-16H2,(H,27,28) |
| InChIKey | ZBVVDCDHRWCHFF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |