C21H17NO6 — CID 87460427
3-[5-(2-phenylmethoxyphenyl)-1,2,4,3-trioxazolidin-3-yl]benzoic acid (PubChem CID 87460427) has the molecular formula C21H17NO6 and a molecular weight of 379.37 g/mol. Its IUPAC name is 3-[5-(2-phenylmethoxyphenyl)-1,2,4,3-trioxazolidin-3-yl]benzoic acid.
| Compound Name | 3-[5-(2-phenylmethoxyphenyl)-1,2,4,3-trioxazolidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 87460427 |
| Molecular Formula | C21H17NO6 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 3-[5-(2-phenylmethoxyphenyl)-1,2,4,3-trioxazolidin-3-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(N2OOC(c3ccccc3OCc3ccccc3)O2)c1 |
| InChI | InChI=1S/C21H17NO6/c23-20(24)16-9-6-10-17(13-16)22-26-21(27-28-22)18-11-4-5-12-19(18)25-14-15-7-2-1-3-8-15/h1-13,21H,14H2,(H,23,24) |
| InChIKey | SEEJJDTVUIPBTC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|