C15H10F3NO6 — CID 87459516
3-[5-[3-(trifluoromethoxy)phenyl]-1,2,4,3-trioxazolidin-3-yl]benzoic acid (PubChem CID 87459516) has the molecular formula C15H10F3NO6 and a molecular weight of 357.24 g/mol. Its IUPAC name is 3-[5-[3-(trifluoromethoxy)phenyl]-1,2,4,3-trioxazolidin-3-yl]benzoic acid.
| Compound Name | 3-[5-[3-(trifluoromethoxy)phenyl]-1,2,4,3-trioxazolidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 87459516 |
| Molecular Formula | C15H10F3NO6 |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 3-[5-[3-(trifluoromethoxy)phenyl]-1,2,4,3-trioxazolidin-3-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(N2OOC(c3cccc(OC(F)(F)F)c3)O2)c1 |
| InChI | InChI=1S/C15H10F3NO6/c16-15(17,18)22-12-6-2-4-10(8-12)14-23-19(25-24-14)11-5-1-3-9(7-11)13(20)21/h1-8,14H,(H,20,21) |
| InChIKey | WLHAJJNAYGRVTC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|