C15H10F3NO5 — CID 87460357
3-[5-[2-(trifluoromethyl)phenyl]-1,2,4,3-trioxazolidin-3-yl]benzoic acid (PubChem CID 87460357) has the molecular formula C15H10F3NO5 and a molecular weight of 341.24 g/mol. Its IUPAC name is 3-[5-[2-(trifluoromethyl)phenyl]-1,2,4,3-trioxazolidin-3-yl]benzoic acid.
| Compound Name | 3-[5-[2-(trifluoromethyl)phenyl]-1,2,4,3-trioxazolidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 87460357 |
| Molecular Formula | C15H10F3NO5 |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 3-[5-[2-(trifluoromethyl)phenyl]-1,2,4,3-trioxazolidin-3-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(N2OOC(c3ccccc3C(F)(F)F)O2)c1 |
| InChI | InChI=1S/C15H10F3NO5/c16-15(17,18)12-7-2-1-6-11(12)14-22-19(24-23-14)10-5-3-4-9(8-10)13(20)21/h1-8,14H,(H,20,21) |
| InChIKey | SZPDVAIEYMERFW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|