C14H10N4O5 — CID 91220703
3-[5-(2-azidophenyl)-1,2,4,3-trioxazolidin-3-yl]benzoic acid (PubChem CID 91220703) has the molecular formula C14H10N4O5 and a molecular weight of 314.26 g/mol. Its IUPAC name is 3-[5-(2-azidophenyl)-1,2,4,3-trioxazolidin-3-yl]benzoic acid.
| Compound Name | 3-[5-(2-azidophenyl)-1,2,4,3-trioxazolidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 91220703 |
| Molecular Formula | C14H10N4O5 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 3-[5-(2-azidophenyl)-1,2,4,3-trioxazolidin-3-yl]benzoic acid |
| SMILES | [N-]=[N+]=Nc1ccccc1C1OON(c2cccc(C(=O)O)c2)O1 |
| InChI | InChI=1S/C14H10N4O5/c15-17-16-12-7-2-1-6-11(12)14-21-18(23-22-14)10-5-3-4-9(8-10)13(19)20/h1-8,14H,(H,19,20) |
| InChIKey | ZYGXLWBIPTWUAU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 116.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|