C39H36O8 — CID 154481766
4-[[2-(dioxan-3-yl)-6-phenylmethoxyphenyl]-hydroxymethyl]-3,5-bis(phenylmethoxy)benzoic acid (PubChem CID 154481766) has the molecular formula C39H36O8 and a molecular weight of 632.71 g/mol. Its IUPAC name is 4-[[2-(dioxan-3-yl)-6-phenylmethoxyphenyl]-hydroxymethyl]-3,5-bis(phenylmethoxy)benzoic acid.
| Compound Name | 4-[[2-(dioxan-3-yl)-6-phenylmethoxyphenyl]-hydroxymethyl]-3,5-bis(phenylmethoxy)benzoic acid |
|---|---|
| PubChem CID | 154481766 |
| Molecular Formula | C39H36O8 |
| Molecular Weight | 632.71 g/mol |
| Exact Mass | 632.24 |
| IUPAC Name | 4-[[2-(dioxan-3-yl)-6-phenylmethoxyphenyl]-hydroxymethyl]-3,5-bis(phenylmethoxy)benzoic acid |
| SMILES | O=C(O)c1cc(OCc2ccccc2)c(C(O)c2c(OCc3ccccc3)cccc2C2CCCOO2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C39H36O8/c40-38(36-31(32-20-11-21-46-47-32)18-10-19-33(36)43-24-27-12-4-1-5-13-27)37-34(44-25-28-14-6-2-7-15-28)22-30(39(41)42)23-35(37)45-26-29-16-8-3-9-17-29/h1-10,12-19,22-23,32,38,40H,11,20-21,24-26H2,(H,41,42) |
| InChIKey | OXJHDPMMEAWNFF-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.71 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|