C16H15ClO4 — CID 57425044
4-chloro-2-(1,3-dioxolan-2-yl)-5-phenylmethoxyphenol (PubChem CID 57425044) has the molecular formula C16H15ClO4 and a molecular weight of 306.74 g/mol. Its IUPAC name is 4-chloro-2-(1,3-dioxolan-2-yl)-5-phenylmethoxyphenol.
| Compound Name | 4-chloro-2-(1,3-dioxolan-2-yl)-5-phenylmethoxyphenol |
|---|---|
| PubChem CID | 57425044 |
| Molecular Formula | C16H15ClO4 |
| Molecular Weight | 306.74 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 4-chloro-2-(1,3-dioxolan-2-yl)-5-phenylmethoxyphenol |
| SMILES | Oc1cc(OCc2ccccc2)c(Cl)cc1C1OCCO1 |
| InChI | InChI=1S/C16H15ClO4/c17-13-8-12(16-19-6-7-20-16)14(18)9-15(13)21-10-11-4-2-1-3-5-11/h1-5,8-9,16,18H,6-7,10H2 |
| InChIKey | QRKNQUYQGIZZNQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.74 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |