C31H29NO6 — CID 139636777
(4R,5S)-4,5-bis(4-methoxy-2-phenylmethoxyphenyl)-1,3-oxazolidin-2-one (PubChem CID 139636777) has the molecular formula C31H29NO6 and a molecular weight of 511.57 g/mol. Its IUPAC name is (4R,5S)-4,5-bis(4-methoxy-2-phenylmethoxyphenyl)-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-4,5-bis(4-methoxy-2-phenylmethoxyphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139636777 |
| Molecular Formula | C31H29NO6 |
| Molecular Weight | 511.57 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | (4R,5S)-4,5-bis(4-methoxy-2-phenylmethoxyphenyl)-1,3-oxazolidin-2-one |
| SMILES | COc1ccc([C@H]2NC(=O)O[C@H]2c2ccc(OC)cc2OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C31H29NO6/c1-34-23-13-15-25(27(17-23)36-19-21-9-5-3-6-10-21)29-30(38-31(33)32-29)26-16-14-24(35-2)18-28(26)37-20-22-11-7-4-8-12-22/h3-18,29-30H,19-20H2,1-2H3,(H,32,33)/t29-,30+/m1/s1 |
| InChIKey | UQFOZJDXPFWNJI-IHLOFXLRSA-N |
| XLogP | 6.38 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.57 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |