C31H31NO3S — CID 143652001
ethane;4-(4-methoxy-2-phenylmethoxyphenyl)-1-(4-phenylphenyl)-3-sulfanylazetidin-2-one (PubChem CID 143652001) has the molecular formula C31H31NO3S and a molecular weight of 497.66 g/mol. Its IUPAC name is ethane;4-(4-methoxy-2-phenylmethoxyphenyl)-1-(4-phenylphenyl)-3-sulfanylazetidin-2-one.
| Compound Name | ethane;4-(4-methoxy-2-phenylmethoxyphenyl)-1-(4-phenylphenyl)-3-sulfanylazetidin-2-one |
|---|---|
| PubChem CID | 143652001 |
| Molecular Formula | C31H31NO3S |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | ethane;4-(4-methoxy-2-phenylmethoxyphenyl)-1-(4-phenylphenyl)-3-sulfanylazetidin-2-one |
| SMILES | CC.COc1ccc(C2C(S)C(=O)N2c2ccc(-c3ccccc3)cc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C29H25NO3S.C2H6/c1-32-24-16-17-25(26(18-24)33-19-20-8-4-2-5-9-20)27-28(34)29(31)30(27)23-14-12-22(13-15-23)21-10-6-3-7-11-21;1-2/h2-18,27-28,34H,19H2,1H3;1-2H3 |
| InChIKey | PZZSEMFAHBZLMT-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 38.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|