C34H32N2O6 — CID 143651905
4-(4-methoxy-2-phenylmethoxyphenyl)-1-(4-phenylphenyl)azetidin-2-one;3-methoxypyrrolidine-2,5-dione (PubChem CID 143651905) has the molecular formula C34H32N2O6 and a molecular weight of 564.64 g/mol. Its IUPAC name is 4-(4-methoxy-2-phenylmethoxyphenyl)-1-(4-phenylphenyl)azetidin-2-one;3-methoxypyrrolidine-2,5-dione.
| Compound Name | 4-(4-methoxy-2-phenylmethoxyphenyl)-1-(4-phenylphenyl)azetidin-2-one;3-methoxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 143651905 |
| Molecular Formula | C34H32N2O6 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | 4-(4-methoxy-2-phenylmethoxyphenyl)-1-(4-phenylphenyl)azetidin-2-one;3-methoxypyrrolidine-2,5-dione |
| SMILES | COC1CC(=O)NC1=O.COc1ccc(C2CC(=O)N2c2ccc(-c3ccccc3)cc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C29H25NO3.C5H7NO3/c1-32-25-16-17-26(28(18-25)33-20-21-8-4-2-5-9-21)27-19-29(31)30(27)24-14-12-23(13-15-24)22-10-6-3-7-11-22;1-9-3-2-4(7)6-5(3)8/h2-18,27H,19-20H2,1H3;3H,2H2,1H3,(H,6,7,8) |
| InChIKey | OIKMTIZVCLIHNC-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|