C22H18FNO2 — CID 10882566
(4S)-1-(4-fluorophenyl)-4-(4-phenylmethoxyphenyl)azetidin-2-one (PubChem CID 10882566) has the molecular formula C22H18FNO2 and a molecular weight of 347.39 g/mol. Its IUPAC name is (4S)-1-(4-fluorophenyl)-4-(4-phenylmethoxyphenyl)azetidin-2-one.
| Compound Name | (4S)-1-(4-fluorophenyl)-4-(4-phenylmethoxyphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 10882566 |
| Molecular Formula | C22H18FNO2 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | (4S)-1-(4-fluorophenyl)-4-(4-phenylmethoxyphenyl)azetidin-2-one |
| SMILES | O=C1C[C@@H](c2ccc(OCc3ccccc3)cc2)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C22H18FNO2/c23-18-8-10-19(11-9-18)24-21(14-22(24)25)17-6-12-20(13-7-17)26-15-16-4-2-1-3-5-16/h1-13,21H,14-15H2/t21-/m0/s1 |
| InChIKey | HWGWDJMHZKGCPW-NRFANRHFSA-N |
| XLogP | 4.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |