C24H21F2NO3 — CID 145351703
1-(4-fluorophenyl)-4-(4-hydroxyphenyl)azetidin-2-one;1-(4-fluorophenyl)propan-1-one (PubChem CID 145351703) has the molecular formula C24H21F2NO3 and a molecular weight of 409.43 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-(4-hydroxyphenyl)azetidin-2-one;1-(4-fluorophenyl)propan-1-one.
| Compound Name | 1-(4-fluorophenyl)-4-(4-hydroxyphenyl)azetidin-2-one;1-(4-fluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 145351703 |
| Molecular Formula | C24H21F2NO3 |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 1-(4-fluorophenyl)-4-(4-hydroxyphenyl)azetidin-2-one;1-(4-fluorophenyl)propan-1-one |
| SMILES | CCC(=O)c1ccc(F)cc1.O=C1CC(c2ccc(O)cc2)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C15H12FNO2.C9H9FO/c16-11-3-5-12(6-4-11)17-14(9-15(17)19)10-1-7-13(18)8-2-10;1-2-9(11)7-3-5-8(10)6-4-7/h1-8,14,18H,9H2;3-6H,2H2,1H3 |
| InChIKey | YPCCWTISJLEEEH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |