C24H25FI2NO3P — CID 143439196
(1S)-1-(4-fluorophenyl)propan-1-ol;(4S)-4-(4-hydroxyphenyl)-1-(4-iodophenyl)azetidin-2-one;iodophosphane (PubChem CID 143439196) has the molecular formula C24H25FI2NO3P and a molecular weight of 679.25 g/mol. Its IUPAC name is (1S)-1-(4-fluorophenyl)propan-1-ol;(4S)-4-(4-hydroxyphenyl)-1-(4-iodophenyl)azetidin-2-one;iodophosphane.
| Compound Name | (1S)-1-(4-fluorophenyl)propan-1-ol;(4S)-4-(4-hydroxyphenyl)-1-(4-iodophenyl)azetidin-2-one;iodophosphane |
|---|---|
| PubChem CID | 143439196 |
| Molecular Formula | C24H25FI2NO3P |
| Molecular Weight | 679.25 g/mol |
| Exact Mass | 678.96 |
| IUPAC Name | (1S)-1-(4-fluorophenyl)propan-1-ol;(4S)-4-(4-hydroxyphenyl)-1-(4-iodophenyl)azetidin-2-one;iodophosphane |
| SMILES | CC[C@H](O)c1ccc(F)cc1.O=C1C[C@@H](c2ccc(O)cc2)N1c1ccc(I)cc1.PI |
| InChI | InChI=1S/C15H12INO2.C9H11FO.H2IP/c16-11-3-5-12(6-4-11)17-14(9-15(17)19)10-1-7-13(18)8-2-10;1-2-9(11)7-3-5-8(10)6-4-7;1-2/h1-8,14,18H,9H2;3-6,9,11H,2H2,1H3;2H2/t14-;9-;/m00./s1 |
| InChIKey | KLRDLKLGDUSECY-MPSYHLDTSA-N |
| XLogP | 6.96 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.25 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|