C26H29F2NO3 — CID 142157318
1-(4-fluorophenyl)-4-methylazetidin-2-one;1-(4-fluorophenyl)propan-1-ol;4-methylphenol (PubChem CID 142157318) has the molecular formula C26H29F2NO3 and a molecular weight of 441.52 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-methylazetidin-2-one;1-(4-fluorophenyl)propan-1-ol;4-methylphenol.
| Compound Name | 1-(4-fluorophenyl)-4-methylazetidin-2-one;1-(4-fluorophenyl)propan-1-ol;4-methylphenol |
|---|---|
| PubChem CID | 142157318 |
| Molecular Formula | C26H29F2NO3 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 1-(4-fluorophenyl)-4-methylazetidin-2-one;1-(4-fluorophenyl)propan-1-ol;4-methylphenol |
| SMILES | CC1CC(=O)N1c1ccc(F)cc1.CCC(O)c1ccc(F)cc1.Cc1ccc(O)cc1 |
| InChI | InChI=1S/C10H10FNO.C9H11FO.C7H8O/c1-7-6-10(13)12(7)9-4-2-8(11)3-5-9;1-2-9(11)7-3-5-8(10)6-4-7;1-6-2-4-7(8)5-3-6/h2-5,7H,6H2,1H3;3-6,9,11H,2H2,1H3;2-5,8H,1H3 |
| InChIKey | ZBLSYKKYCOFQPR-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |