C32H40FNO4 — CID 143721518
1,4-bis[4-(4-hydroxybutyl)phenyl]azetidin-2-one;1-(4-fluorophenyl)propan-1-ol (PubChem CID 143721518) has the molecular formula C32H40FNO4 and a molecular weight of 521.67 g/mol. Its IUPAC name is 1,4-bis[4-(4-hydroxybutyl)phenyl]azetidin-2-one;1-(4-fluorophenyl)propan-1-ol.
| Compound Name | 1,4-bis[4-(4-hydroxybutyl)phenyl]azetidin-2-one;1-(4-fluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 143721518 |
| Molecular Formula | C32H40FNO4 |
| Molecular Weight | 521.67 g/mol |
| Exact Mass | 521.29 |
| IUPAC Name | 1,4-bis[4-(4-hydroxybutyl)phenyl]azetidin-2-one;1-(4-fluorophenyl)propan-1-ol |
| SMILES | CCC(O)c1ccc(F)cc1.O=C1CC(c2ccc(CCCCO)cc2)N1c1ccc(CCCCO)cc1 |
| InChI | InChI=1S/C23H29NO3.C9H11FO/c25-15-3-1-5-18-7-11-20(12-8-18)22-17-23(27)24(22)21-13-9-19(10-14-21)6-2-4-16-26;1-2-9(11)7-3-5-8(10)6-4-7/h7-14,22,25-26H,1-6,15-17H2;3-6,9,11H,2H2,1H3 |
| InChIKey | AWVXNUZBKUEDMI-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.67 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|