C33H41FN2O6S — CID 143721596
[(1S)-1-(4-fluorophenyl)propyl] acetate;1-[4-[3-(methylsulfanylamino)propyl]phenyl]-4-[4-(1,2,3-trihydroxypropan-2-yl)phenyl]azetidin-2-one (PubChem CID 143721596) has the molecular formula C33H41FN2O6S and a molecular weight of 612.76 g/mol. Its IUPAC name is [(1S)-1-(4-fluorophenyl)propyl] acetate;1-[4-[3-(methylsulfanylamino)propyl]phenyl]-4-[4-(1,2,3-trihydroxypropan-2-yl)phenyl]azetidin-2-one.
| Compound Name | [(1S)-1-(4-fluorophenyl)propyl] acetate;1-[4-[3-(methylsulfanylamino)propyl]phenyl]-4-[4-(1,2,3-trihydroxypropan-2-yl)phenyl]azetidin-2-one |
|---|---|
| PubChem CID | 143721596 |
| Molecular Formula | C33H41FN2O6S |
| Molecular Weight | 612.76 g/mol |
| Exact Mass | 612.27 |
| IUPAC Name | [(1S)-1-(4-fluorophenyl)propyl] acetate;1-[4-[3-(methylsulfanylamino)propyl]phenyl]-4-[4-(1,2,3-trihydroxypropan-2-yl)phenyl]azetidin-2-one |
| SMILES | CC[C@H](OC(C)=O)c1ccc(F)cc1.CSNCCCc1ccc(N2C(=O)CC2c2ccc(C(O)(CO)CO)cc2)cc1 |
| InChI | InChI=1S/C22H28N2O4S.C11H13FO2/c1-29-23-12-2-3-16-4-10-19(11-5-16)24-20(13-21(24)27)17-6-8-18(9-7-17)22(28,14-25)15-26;1-3-11(14-8(2)13)9-4-6-10(12)7-5-9/h4-11,20,23,25-26,28H,2-3,12-15H2,1H3;4-7,11H,3H2,1-2H3/t;11-/m.0/s1 |
| InChIKey | OBVYKYDXYUTHML-WUSPCOQVSA-N |
| XLogP | 4.98 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.76 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|