C23H29NO3 — CID 143721519
1,4-bis[4-(4-hydroxybutyl)phenyl]azetidin-2-one (PubChem CID 143721519) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is 1,4-bis[4-(4-hydroxybutyl)phenyl]azetidin-2-one.
| Compound Name | 1,4-bis[4-(4-hydroxybutyl)phenyl]azetidin-2-one |
|---|---|
| PubChem CID | 143721519 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 1,4-bis[4-(4-hydroxybutyl)phenyl]azetidin-2-one |
| SMILES | O=C1CC(c2ccc(CCCCO)cc2)N1c1ccc(CCCCO)cc1 |
| InChI | InChI=1S/C23H29NO3/c25-15-3-1-5-18-7-11-20(12-8-18)22-17-23(27)24(22)21-13-9-19(10-14-21)6-2-4-16-26/h7-14,22,25-26H,1-6,15-17H2 |
| InChIKey | OLKZCVFWQPIWNP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|