C12H15NO3 — CID 117315639
2-[4-(3-hydroxypropyl)phenyl]-1,2-oxazolidin-3-one (PubChem CID 117315639) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-[4-(3-hydroxypropyl)phenyl]-1,2-oxazolidin-3-one.
| Compound Name | 2-[4-(3-hydroxypropyl)phenyl]-1,2-oxazolidin-3-one |
|---|---|
| PubChem CID | 117315639 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 2-[4-(3-hydroxypropyl)phenyl]-1,2-oxazolidin-3-one |
| SMILES | O=C1CCON1c1ccc(CCCO)cc1 |
| InChI | InChI=1S/C12H15NO3/c14-8-1-2-10-3-5-11(6-4-10)13-12(15)7-9-16-13/h3-6,14H,1-2,7-9H2 |
| InChIKey | AUXOCRLIHVQVOB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |