C15H20N2O2 — CID 117405204
2-[4-(piperidin-4-ylmethyl)phenyl]-1,2-oxazolidin-3-one (PubChem CID 117405204) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-[4-(piperidin-4-ylmethyl)phenyl]-1,2-oxazolidin-3-one.
| Compound Name | 2-[4-(piperidin-4-ylmethyl)phenyl]-1,2-oxazolidin-3-one |
|---|---|
| PubChem CID | 117405204 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 2-[4-(piperidin-4-ylmethyl)phenyl]-1,2-oxazolidin-3-one |
| SMILES | O=C1CCON1c1ccc(CC2CCNCC2)cc1 |
| InChI | InChI=1S/C15H20N2O2/c18-15-7-10-19-17(15)14-3-1-12(2-4-14)11-13-5-8-16-9-6-13/h1-4,13,16H,5-11H2 |
| InChIKey | GCCRRUBLEDIGCM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |