C19H16F3NO4S — CID 143668979
[4-[(4S)-2-oxo-4-(4-prop-2-enylphenyl)azetidin-1-yl]phenyl] trifluoromethanesulfonate (PubChem CID 143668979) has the molecular formula C19H16F3NO4S and a molecular weight of 411.40 g/mol. Its IUPAC name is [4-[(4S)-2-oxo-4-(4-prop-2-enylphenyl)azetidin-1-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[(4S)-2-oxo-4-(4-prop-2-enylphenyl)azetidin-1-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 143668979 |
| Molecular Formula | C19H16F3NO4S |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | [4-[(4S)-2-oxo-4-(4-prop-2-enylphenyl)azetidin-1-yl]phenyl] trifluoromethanesulfonate |
| SMILES | C=CCc1ccc([C@@H]2CC(=O)N2c2ccc(OS(=O)(=O)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H16F3NO4S/c1-2-3-13-4-6-14(7-5-13)17-12-18(24)23(17)15-8-10-16(11-9-15)27-28(25,26)19(20,21)22/h2,4-11,17H,1,3,12H2/t17-/m0/s1 |
| InChIKey | SPNPEGLBUMVUHU-KRWDZBQOSA-N |
| XLogP | 4.12 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|