C21H20N2O5S — CID 143377501
[4-[(2S)-1-[4-[3-(methanesulfonamido)prop-1-ynyl]phenyl]-4-oxoazetidin-2-yl]phenyl] acetate (PubChem CID 143377501) has the molecular formula C21H20N2O5S and a molecular weight of 412.47 g/mol. Its IUPAC name is [4-[(2S)-1-[4-[3-(methanesulfonamido)prop-1-ynyl]phenyl]-4-oxoazetidin-2-yl]phenyl] acetate.
| Compound Name | [4-[(2S)-1-[4-[3-(methanesulfonamido)prop-1-ynyl]phenyl]-4-oxoazetidin-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 143377501 |
| Molecular Formula | C21H20N2O5S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | [4-[(2S)-1-[4-[3-(methanesulfonamido)prop-1-ynyl]phenyl]-4-oxoazetidin-2-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc([C@@H]2CC(=O)N2c2ccc(C#CCNS(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C21H20N2O5S/c1-15(24)28-19-11-7-17(8-12-19)20-14-21(25)23(20)18-9-5-16(6-10-18)4-3-13-22-29(2,26)27/h5-12,20,22H,13-14H2,1-2H3/t20-/m0/s1 |
| InChIKey | ILPFKACHIAQGBX-FQEVSTJZSA-N |
| XLogP | 1.99 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|