C16H15NO2 — CID 143669012
1-(4-hydroxyphenyl)-4-(4-methylphenyl)azetidin-2-one (PubChem CID 143669012) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 1-(4-hydroxyphenyl)-4-(4-methylphenyl)azetidin-2-one.
| Compound Name | 1-(4-hydroxyphenyl)-4-(4-methylphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 143669012 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 1-(4-hydroxyphenyl)-4-(4-methylphenyl)azetidin-2-one |
| SMILES | Cc1ccc(C2CC(=O)N2c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C16H15NO2/c1-11-2-4-12(5-3-11)15-10-16(19)17(15)13-6-8-14(18)9-7-13/h2-9,15,18H,10H2,1H3 |
| InChIKey | PEKPZAUQIKLOMQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |