C26H25F4NO5S — CID 143669022
1-(4-fluorophenyl)propan-1-ol;[4-[2-(4-methylphenyl)-4-oxoazetidin-1-yl]phenyl] trifluoromethanesulfonate (PubChem CID 143669022) has the molecular formula C26H25F4NO5S and a molecular weight of 539.55 g/mol. Its IUPAC name is 1-(4-fluorophenyl)propan-1-ol;[4-[2-(4-methylphenyl)-4-oxoazetidin-1-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | 1-(4-fluorophenyl)propan-1-ol;[4-[2-(4-methylphenyl)-4-oxoazetidin-1-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 143669022 |
| Molecular Formula | C26H25F4NO5S |
| Molecular Weight | 539.55 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | 1-(4-fluorophenyl)propan-1-ol;[4-[2-(4-methylphenyl)-4-oxoazetidin-1-yl]phenyl] trifluoromethanesulfonate |
| SMILES | CCC(O)c1ccc(F)cc1.Cc1ccc(C2CC(=O)N2c2ccc(OS(=O)(=O)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H14F3NO4S.C9H11FO/c1-11-2-4-12(5-3-11)15-10-16(22)21(15)13-6-8-14(9-7-13)25-26(23,24)17(18,19)20;1-2-9(11)7-3-5-8(10)6-4-7/h2-9,15H,10H2,1H3;3-6,9,11H,2H2,1H3 |
| InChIKey | MWDMVIHJFBHZGL-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.55 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|