C25H20F5NO5S — CID 87107521
[4-[(2S)-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxoazetidin-2-yl]phenyl] trifluoromethanesulfonate (PubChem CID 87107521) has the molecular formula C25H20F5NO5S and a molecular weight of 541.49 g/mol. Its IUPAC name is [4-[(2S)-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxoazetidin-2-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[(2S)-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxoazetidin-2-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87107521 |
| Molecular Formula | C25H20F5NO5S |
| Molecular Weight | 541.49 g/mol |
| Exact Mass | 541.10 |
| IUPAC Name | [4-[(2S)-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxoazetidin-2-yl]phenyl] trifluoromethanesulfonate |
| SMILES | O=C1C(CC[C@H](O)c2ccc(F)cc2)[C@@H](c2ccc(OS(=O)(=O)C(F)(F)F)cc2)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C25H20F5NO5S/c26-17-5-1-15(2-6-17)22(32)14-13-21-23(31(24(21)33)19-9-7-18(27)8-10-19)16-3-11-20(12-4-16)36-37(34,35)25(28,29)30/h1-12,21-23,32H,13-14H2/t21?,22-,23+/m0/s1 |
| InChIKey | SGAWEGAPBBKHNF-ATTQYFOMSA-N |
| XLogP | 5.41 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|