C27H22F5NO6S — CID 58895823
[(1S)-1-(4-fluorophenyl)-3-[(3R,4S)-1-(4-fluorophenyl)-2-oxo-4-[4-(trifluoromethylsulfonyloxy)phenyl]azetidin-3-yl]propyl] acetate (PubChem CID 58895823) has the molecular formula C27H22F5NO6S and a molecular weight of 583.53 g/mol. Its IUPAC name is [(1S)-1-(4-fluorophenyl)-3-[(3R,4S)-1-(4-fluorophenyl)-2-oxo-4-[4-(trifluoromethylsulfonyloxy)phenyl]azetidin-3-yl]propyl] acetate.
| Compound Name | [(1S)-1-(4-fluorophenyl)-3-[(3R,4S)-1-(4-fluorophenyl)-2-oxo-4-[4-(trifluoromethylsulfonyloxy)phenyl]azetidin-3-yl]propyl] acetate |
|---|---|
| PubChem CID | 58895823 |
| Molecular Formula | C27H22F5NO6S |
| Molecular Weight | 583.53 g/mol |
| Exact Mass | 583.11 |
| IUPAC Name | [(1S)-1-(4-fluorophenyl)-3-[(3R,4S)-1-(4-fluorophenyl)-2-oxo-4-[4-(trifluoromethylsulfonyloxy)phenyl]azetidin-3-yl]propyl] acetate |
| SMILES | CC(=O)O[C@@H](CC[C@H]1C(=O)N(c2ccc(F)cc2)[C@@H]1c1ccc(OS(=O)(=O)C(F)(F)F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H22F5NO6S/c1-16(34)38-24(17-2-6-19(28)7-3-17)15-14-23-25(33(26(23)35)21-10-8-20(29)9-11-21)18-4-12-22(13-5-18)39-40(36,37)27(30,31)32/h2-13,23-25H,14-15H2,1H3/t23-,24+,25-/m1/s1 |
| InChIKey | LERZDQXZEJZOBW-DSNGMDLFSA-N |
| XLogP | 5.98 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.53 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|