C32H29F4NO8S — CID 89260472
[(1S)-3-[(3R,4S)-1-[4-(3-ethoxy-3-hydroxyprop-1-ynyl)phenyl]-2-oxo-4-[4-(trifluoromethylsulfonyloxy)phenyl]azetidin-3-yl]-1-(4-fluorophenyl)propyl] acetate (PubChem CID 89260472) has the molecular formula C32H29F4NO8S and a molecular weight of 663.64 g/mol. Its IUPAC name is [(1S)-3-[(3R,4S)-1-[4-(3-ethoxy-3-hydroxyprop-1-ynyl)phenyl]-2-oxo-4-[4-(trifluoromethylsulfonyloxy)phenyl]azetidin-3-yl]-1-(4-fluorophenyl)propyl] acetate.
| Compound Name | [(1S)-3-[(3R,4S)-1-[4-(3-ethoxy-3-hydroxyprop-1-ynyl)phenyl]-2-oxo-4-[4-(trifluoromethylsulfonyloxy)phenyl]azetidin-3-yl]-1-(4-fluorophenyl)propyl] acetate |
|---|---|
| PubChem CID | 89260472 |
| Molecular Formula | C32H29F4NO8S |
| Molecular Weight | 663.64 g/mol |
| Exact Mass | 663.16 |
| IUPAC Name | [(1S)-3-[(3R,4S)-1-[4-(3-ethoxy-3-hydroxyprop-1-ynyl)phenyl]-2-oxo-4-[4-(trifluoromethylsulfonyloxy)phenyl]azetidin-3-yl]-1-(4-fluorophenyl)propyl] acetate |
| SMILES | CCOC(O)C#Cc1ccc(N2C(=O)[C@H](CC[C@H](OC(C)=O)c3ccc(F)cc3)[C@H]2c2ccc(OS(=O)(=O)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C32H29F4NO8S/c1-3-43-29(39)19-6-21-4-13-25(14-5-21)37-30(23-9-15-26(16-10-23)45-46(41,42)32(34,35)36)27(31(37)40)17-18-28(44-20(2)38)22-7-11-24(33)12-8-22/h4-5,7-16,27-30,39H,3,17-18H2,1-2H3/t27-,28+,29?,30-/m1/s1 |
| InChIKey | OXYLBFZSFYQFSD-LKDZJTDUSA-N |
| XLogP | 5.55 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.64 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|