C31H32F4N2O8S2 — CID 143721571
[1-(4-fluorophenyl)-3-[(3R)-1-[4-[3-(methanesulfonamido)propyl]phenyl]-2-oxo-4-[4-(trifluoromethylsulfonyloxy)phenyl]azetidin-3-yl]propyl] acetate (PubChem CID 143721571) has the molecular formula C31H32F4N2O8S2 and a molecular weight of 700.73 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-3-[(3R)-1-[4-[3-(methanesulfonamido)propyl]phenyl]-2-oxo-4-[4-(trifluoromethylsulfonyloxy)phenyl]azetidin-3-yl]propyl] acetate.
| Compound Name | [1-(4-fluorophenyl)-3-[(3R)-1-[4-[3-(methanesulfonamido)propyl]phenyl]-2-oxo-4-[4-(trifluoromethylsulfonyloxy)phenyl]azetidin-3-yl]propyl] acetate |
|---|---|
| PubChem CID | 143721571 |
| Molecular Formula | C31H32F4N2O8S2 |
| Molecular Weight | 700.73 g/mol |
| Exact Mass | 700.15 |
| IUPAC Name | [1-(4-fluorophenyl)-3-[(3R)-1-[4-[3-(methanesulfonamido)propyl]phenyl]-2-oxo-4-[4-(trifluoromethylsulfonyloxy)phenyl]azetidin-3-yl]propyl] acetate |
| SMILES | CC(=O)OC(CC[C@H]1C(=O)N(c2ccc(CCCNS(C)(=O)=O)cc2)C1c1ccc(OS(=O)(=O)C(F)(F)F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C31H32F4N2O8S2/c1-20(38)44-28(22-7-11-24(32)12-8-22)18-17-27-29(23-9-15-26(16-10-23)45-47(42,43)31(33,34)35)37(30(27)39)25-13-5-21(6-14-25)4-3-19-36-46(2,40)41/h5-16,27-29,36H,3-4,17-19H2,1-2H3/t27-,28?,29?/m1/s1 |
| InChIKey | BOBOBHWLDVOAKU-JMYZALGVSA-N |
| XLogP | 5.32 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.73 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|