C35H41FN2O8S — CID 46204602
2-[3-[4-[(2S,3R)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-1-[4-[4-(methanesulfonamido)butyl]phenyl]-4-oxoazetidin-2-yl]phenyl]propyl]propanedioic acid (PubChem CID 46204602) has the molecular formula C35H41FN2O8S and a molecular weight of 668.78 g/mol. Its IUPAC name is 2-[3-[4-[(2S,3R)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-1-[4-[4-(methanesulfonamido)butyl]phenyl]-4-oxoazetidin-2-yl]phenyl]propyl]propanedioic acid.
| Compound Name | 2-[3-[4-[(2S,3R)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-1-[4-[4-(methanesulfonamido)butyl]phenyl]-4-oxoazetidin-2-yl]phenyl]propyl]propanedioic acid |
|---|---|
| PubChem CID | 46204602 |
| Molecular Formula | C35H41FN2O8S |
| Molecular Weight | 668.78 g/mol |
| Exact Mass | 668.26 |
| IUPAC Name | 2-[3-[4-[(2S,3R)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-1-[4-[4-(methanesulfonamido)butyl]phenyl]-4-oxoazetidin-2-yl]phenyl]propyl]propanedioic acid |
| SMILES | CS(=O)(=O)NCCCCc1ccc(N2C(=O)[C@H](CC[C@H](O)c3ccc(F)cc3)[C@H]2c2ccc(CCCC(C(=O)O)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C35H41FN2O8S/c1-47(45,46)37-22-3-2-5-23-10-18-28(19-11-23)38-32(29(33(38)40)20-21-31(39)25-14-16-27(36)17-15-25)26-12-8-24(9-13-26)6-4-7-30(34(41)42)35(43)44/h8-19,29-32,37,39H,2-7,20-22H2,1H3,(H,41,42)(H,43,44)/t29-,31+,32-/m1/s1 |
| InChIKey | AAMJLPKBQUELAZ-YZRKUJAWSA-N |
| XLogP | 5.02 |
| TPSA | 161.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.78 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|