C38H43FN4O6 — CID 46205886
2-[3-[4-[(2S,3R)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxo-1-[4-[6-(1,2,4-triazol-1-yl)hexyl]phenyl]azetidin-2-yl]phenyl]propyl]propanedioic acid (PubChem CID 46205886) has the molecular formula C38H43FN4O6 and a molecular weight of 670.78 g/mol. Its IUPAC name is 2-[3-[4-[(2S,3R)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxo-1-[4-[6-(1,2,4-triazol-1-yl)hexyl]phenyl]azetidin-2-yl]phenyl]propyl]propanedioic acid.
| Compound Name | 2-[3-[4-[(2S,3R)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxo-1-[4-[6-(1,2,4-triazol-1-yl)hexyl]phenyl]azetidin-2-yl]phenyl]propyl]propanedioic acid |
|---|---|
| PubChem CID | 46205886 |
| Molecular Formula | C38H43FN4O6 |
| Molecular Weight | 670.78 g/mol |
| Exact Mass | 670.32 |
| IUPAC Name | 2-[3-[4-[(2S,3R)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxo-1-[4-[6-(1,2,4-triazol-1-yl)hexyl]phenyl]azetidin-2-yl]phenyl]propyl]propanedioic acid |
| SMILES | O=C(O)C(CCCc1ccc([C@@H]2[C@@H](CC[C@H](O)c3ccc(F)cc3)C(=O)N2c2ccc(CCCCCCn3cncn3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C38H43FN4O6/c39-30-17-15-28(16-18-30)34(44)22-21-32-35(29-13-9-27(10-14-29)7-5-8-33(37(46)47)38(48)49)43(36(32)45)31-19-11-26(12-20-31)6-3-1-2-4-23-42-25-40-24-41-42/h9-20,24-25,32-35,44H,1-8,21-23H2,(H,46,47)(H,48,49)/t32-,34+,35-/m1/s1 |
| InChIKey | VUYFPOBYMBQUCL-VXMNRCMCSA-N |
| XLogP | 6.55 |
| TPSA | 145.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.78 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|