C27H26F2NO7S- — CID 59839613
3-[4-[(2S,3R)-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxoazetidin-2-yl]phenoxy]propyl sulfate (PubChem CID 59839613) has the molecular formula C27H26F2NO7S- and a molecular weight of 546.57 g/mol. Its IUPAC name is 3-[4-[(2S,3R)-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxoazetidin-2-yl]phenoxy]propyl sulfate.
| Compound Name | 3-[4-[(2S,3R)-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxoazetidin-2-yl]phenoxy]propyl sulfate |
|---|---|
| PubChem CID | 59839613 |
| Molecular Formula | C27H26F2NO7S- |
| Molecular Weight | 546.57 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | 3-[4-[(2S,3R)-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-oxoazetidin-2-yl]phenoxy]propyl sulfate |
| SMILES | O=C1[C@H](CC[C@H](O)c2ccc(F)cc2)[C@@H](c2ccc(OCCCOS(=O)(=O)[O-])cc2)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C27H27F2NO7S/c28-20-6-2-18(3-7-20)25(31)15-14-24-26(30(27(24)32)22-10-8-21(29)9-11-22)19-4-12-23(13-5-19)36-16-1-17-37-38(33,34)35/h2-13,24-26,31H,1,14-17H2,(H,33,34,35)/p-1/t24-,25+,26-/m1/s1 |
| InChIKey | FBVYWYINPJZQMK-UODIDJSMSA-M |
| XLogP | 4.43 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.57 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|