C17H23F3O6S2 — CID 174961457
methanesulfonic acid;[4-(4-prop-2-enylcyclohexyl)phenyl] trifluoromethanesulfonate (PubChem CID 174961457) has the molecular formula C17H23F3O6S2 and a molecular weight of 444.49 g/mol. Its IUPAC name is methanesulfonic acid;[4-(4-prop-2-enylcyclohexyl)phenyl] trifluoromethanesulfonate.
| Compound Name | methanesulfonic acid;[4-(4-prop-2-enylcyclohexyl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 174961457 |
| Molecular Formula | C17H23F3O6S2 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | methanesulfonic acid;[4-(4-prop-2-enylcyclohexyl)phenyl] trifluoromethanesulfonate |
| SMILES | C=CCC1CCC(c2ccc(OS(=O)(=O)C(F)(F)F)cc2)CC1.CS(=O)(=O)O |
| InChI | InChI=1S/C16H19F3O3S.CH4O3S/c1-2-3-12-4-6-13(7-5-12)14-8-10-15(11-9-14)22-23(20,21)16(17,18)19;1-5(2,3)4/h2,8-13H,1,3-7H2;1H3,(H,2,3,4) |
| InChIKey | QDGDUDHCYNSUAR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|