C25H32O — CID 67822720
2-methyl-1-[4-[4-(4-prop-2-enylcyclohexyl)phenyl]phenyl]propan-1-ol (PubChem CID 67822720) has the molecular formula C25H32O and a molecular weight of 348.53 g/mol. Its IUPAC name is 2-methyl-1-[4-[4-(4-prop-2-enylcyclohexyl)phenyl]phenyl]propan-1-ol.
| Compound Name | 2-methyl-1-[4-[4-(4-prop-2-enylcyclohexyl)phenyl]phenyl]propan-1-ol |
|---|---|
| PubChem CID | 67822720 |
| Molecular Formula | C25H32O |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | 2-methyl-1-[4-[4-(4-prop-2-enylcyclohexyl)phenyl]phenyl]propan-1-ol |
| SMILES | C=CCC1CCC(c2ccc(-c3ccc(C(O)C(C)C)cc3)cc2)CC1 |
| InChI | InChI=1S/C25H32O/c1-4-5-19-6-8-20(9-7-19)21-10-12-22(13-11-21)23-14-16-24(17-15-23)25(26)18(2)3/h4,10-20,25-26H,1,5-9H2,2-3H3 |
| InChIKey | VPXYIQFJNIPGAQ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|