C25H22FNO2 — CID 139413530
(3R,4S)-1-(4-fluorophenyl)-4-(4-phenylmethoxyphenyl)-3-prop-2-enylazetidin-2-one (PubChem CID 139413530) has the molecular formula C25H22FNO2 and a molecular weight of 387.45 g/mol. Its IUPAC name is (3R,4S)-1-(4-fluorophenyl)-4-(4-phenylmethoxyphenyl)-3-prop-2-enylazetidin-2-one.
| Compound Name | (3R,4S)-1-(4-fluorophenyl)-4-(4-phenylmethoxyphenyl)-3-prop-2-enylazetidin-2-one |
|---|---|
| PubChem CID | 139413530 |
| Molecular Formula | C25H22FNO2 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | (3R,4S)-1-(4-fluorophenyl)-4-(4-phenylmethoxyphenyl)-3-prop-2-enylazetidin-2-one |
| SMILES | C=CC[C@H]1C(=O)N(c2ccc(F)cc2)[C@@H]1c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H22FNO2/c1-2-6-23-24(27(25(23)28)21-13-11-20(26)12-14-21)19-9-15-22(16-10-19)29-17-18-7-4-3-5-8-18/h2-5,7-16,23-24H,1,6,17H2/t23-,24-/m1/s1 |
| InChIKey | GSSQDJFWGSMWCQ-DNQXCXABSA-N |
| XLogP | 5.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|