C25H20Cl2FNO3 — CID 87692011
3-[(2S,3R)-2-[4-[(4-chlorophenyl)methoxy]phenyl]-1-(4-fluorophenyl)-4-oxoazetidin-3-yl]propanoyl chloride (PubChem CID 87692011) has the molecular formula C25H20Cl2FNO3 and a molecular weight of 472.34 g/mol. Its IUPAC name is 3-[(2S,3R)-2-[4-[(4-chlorophenyl)methoxy]phenyl]-1-(4-fluorophenyl)-4-oxoazetidin-3-yl]propanoyl chloride.
| Compound Name | 3-[(2S,3R)-2-[4-[(4-chlorophenyl)methoxy]phenyl]-1-(4-fluorophenyl)-4-oxoazetidin-3-yl]propanoyl chloride |
|---|---|
| PubChem CID | 87692011 |
| Molecular Formula | C25H20Cl2FNO3 |
| Molecular Weight | 472.34 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | 3-[(2S,3R)-2-[4-[(4-chlorophenyl)methoxy]phenyl]-1-(4-fluorophenyl)-4-oxoazetidin-3-yl]propanoyl chloride |
| SMILES | O=C(Cl)CC[C@H]1C(=O)N(c2ccc(F)cc2)[C@@H]1c1ccc(OCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H20Cl2FNO3/c26-18-5-1-16(2-6-18)15-32-21-11-3-17(4-12-21)24-22(13-14-23(27)30)25(31)29(24)20-9-7-19(28)8-10-20/h1-12,22,24H,13-15H2/t22-,24-/m1/s1 |
| InChIKey | AYOFTSFJOTVYLM-ISKFKSNPSA-N |
| XLogP | 6.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.34 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|