C24H20F2NO3P — CID 59660561
(3R,4S)-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-3-oxopropyl]-4-(4-phosphanyloxyphenyl)azetidin-2-one (PubChem CID 59660561) has the molecular formula C24H20F2NO3P and a molecular weight of 439.40 g/mol. Its IUPAC name is (3R,4S)-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-3-oxopropyl]-4-(4-phosphanyloxyphenyl)azetidin-2-one.
| Compound Name | (3R,4S)-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-3-oxopropyl]-4-(4-phosphanyloxyphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 59660561 |
| Molecular Formula | C24H20F2NO3P |
| Molecular Weight | 439.40 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | (3R,4S)-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-3-oxopropyl]-4-(4-phosphanyloxyphenyl)azetidin-2-one |
| SMILES | O=C(CC[C@H]1C(=O)N(c2ccc(F)cc2)[C@@H]1c1ccc(OP)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H20F2NO3P/c25-17-5-1-15(2-6-17)22(28)14-13-21-23(16-3-11-20(30-31)12-4-16)27(24(21)29)19-9-7-18(26)8-10-19/h1-12,21,23H,13-14,31H2/t21-,23-/m1/s1 |
| InChIKey | PUBNDVVJYFVREF-FYYLOGMGSA-N |
| XLogP | 5.50 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.40 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|