C23H20O3 — CID 176508542
1-(2,4-dimethoxyphenyl)-4-ethynyl-2-phenylmethoxybenzene (PubChem CID 176508542) has the molecular formula C23H20O3 and a molecular weight of 344.41 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-4-ethynyl-2-phenylmethoxybenzene.
| Compound Name | 1-(2,4-dimethoxyphenyl)-4-ethynyl-2-phenylmethoxybenzene |
|---|---|
| PubChem CID | 176508542 |
| Molecular Formula | C23H20O3 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-4-ethynyl-2-phenylmethoxybenzene |
| SMILES | C#Cc1ccc(-c2ccc(OC)cc2OC)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H20O3/c1-4-17-10-12-21(20-13-11-19(24-2)15-22(20)25-3)23(14-17)26-16-18-8-6-5-7-9-18/h1,5-15H,16H2,2-3H3 |
| InChIKey | WKDPFDIRSAXOPN-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|