C21H14Cl2O — CID 176508541
2,4-dichloro-1-(4-ethynyl-2-phenylmethoxyphenyl)benzene (PubChem CID 176508541) has the molecular formula C21H14Cl2O and a molecular weight of 353.25 g/mol. Its IUPAC name is 2,4-dichloro-1-(4-ethynyl-2-phenylmethoxyphenyl)benzene.
| Compound Name | 2,4-dichloro-1-(4-ethynyl-2-phenylmethoxyphenyl)benzene |
|---|---|
| PubChem CID | 176508541 |
| Molecular Formula | C21H14Cl2O |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 2,4-dichloro-1-(4-ethynyl-2-phenylmethoxyphenyl)benzene |
| SMILES | C#Cc1ccc(-c2ccc(Cl)cc2Cl)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C21H14Cl2O/c1-2-15-8-10-19(18-11-9-17(22)13-20(18)23)21(12-15)24-14-16-6-4-3-5-7-16/h1,3-13H,14H2 |
| InChIKey | GIXAFTNFAJSFJY-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|