C20H21BrO5 — CID 11464310
2-bromo-5-(1,3-dioxan-2-yl)-3-methoxy-4-methyl-6-phenylmethoxybenzaldehyde (PubChem CID 11464310) has the molecular formula C20H21BrO5 and a molecular weight of 421.29 g/mol. Its IUPAC name is 2-bromo-5-(1,3-dioxan-2-yl)-3-methoxy-4-methyl-6-phenylmethoxybenzaldehyde.
| Compound Name | 2-bromo-5-(1,3-dioxan-2-yl)-3-methoxy-4-methyl-6-phenylmethoxybenzaldehyde |
|---|---|
| PubChem CID | 11464310 |
| Molecular Formula | C20H21BrO5 |
| Molecular Weight | 421.29 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 2-bromo-5-(1,3-dioxan-2-yl)-3-methoxy-4-methyl-6-phenylmethoxybenzaldehyde |
| SMILES | COc1c(C)c(C2OCCCO2)c(OCc2ccccc2)c(C=O)c1Br |
| InChI | InChI=1S/C20H21BrO5/c1-13-16(20-24-9-6-10-25-20)19(15(11-22)17(21)18(13)23-2)26-12-14-7-4-3-5-8-14/h3-5,7-8,11,20H,6,9-10,12H2,1-2H3 |
| InChIKey | DYUPCLXBDQCDAC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.29 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|