C16H16Br2O2 — CID 177011073
2,4-dibromo-3-phenylmethoxybenzaldehyde;ethane (PubChem CID 177011073) has the molecular formula C16H16Br2O2 and a molecular weight of 400.11 g/mol. Its IUPAC name is 2,4-dibromo-3-phenylmethoxybenzaldehyde;ethane.
| Compound Name | 2,4-dibromo-3-phenylmethoxybenzaldehyde;ethane |
|---|---|
| PubChem CID | 177011073 |
| Molecular Formula | C16H16Br2O2 |
| Molecular Weight | 400.11 g/mol |
| Exact Mass | 397.95 |
| IUPAC Name | 2,4-dibromo-3-phenylmethoxybenzaldehyde;ethane |
| SMILES | CC.O=Cc1ccc(Br)c(OCc2ccccc2)c1Br |
| InChI | InChI=1S/C14H10Br2O2.C2H6/c15-12-7-6-11(8-17)13(16)14(12)18-9-10-4-2-1-3-5-10;1-2/h1-8H,9H2;1-2H3 |
| InChIKey | MAIIGUKCIJYVKH-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.11 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|