C16H14O8 — CID 13167346
(5,7-diacetyloxy-2-oxochromen-4-yl)methyl acetate (PubChem CID 13167346) has the molecular formula C16H14O8 and a molecular weight of 334.28 g/mol. Its IUPAC name is (5,7-diacetyloxy-2-oxochromen-4-yl)methyl acetate.
| Compound Name | (5,7-diacetyloxy-2-oxochromen-4-yl)methyl acetate |
|---|---|
| PubChem CID | 13167346 |
| Molecular Formula | C16H14O8 |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | (5,7-diacetyloxy-2-oxochromen-4-yl)methyl acetate |
| SMILES | CC(=O)OCc1cc(=O)oc2cc(OC(C)=O)cc(OC(C)=O)c12 |
| InChI | InChI=1S/C16H14O8/c1-8(17)21-7-11-4-15(20)24-14-6-12(22-9(2)18)5-13(16(11)14)23-10(3)19/h4-6H,7H2,1-3H3 |
| InChIKey | BIGQBJODSXLOAH-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 109.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|