(6,8-diacetyloxy-9-oxoxanthen-3-yl) acetate

C19H14O8 — CID 70687596

IUPAC(6,8-diacetyloxy-9-oxoxanthen-3-yl) acetate
SMILESCC(=O)Oc1ccc2c(=O)c3c(OC(C)=O)cc(OC(C)=O)cc3oc2c1
InChIInChI=1S/C19H14O8/c1-9(20)24-12-4-5-14-15(6-12)27-17-8-13(25-10(2)21)7-16(26-11(3)22)18(17)19(14)23/h4-8H,1-3H3
InChIKeyADQSTMGPNSJMME-UHFFFAOYSA-N
MW370.31 g/mol
LogP2.72
Rot. Bonds3

About (6,8-diacetyloxy-9-oxoxanthen-3-yl) acetate

(6,8-diacetyloxy-9-oxoxanthen-3-yl) acetate (PubChem CID 70687596) has the molecular formula C19H14O8 and a molecular weight of 370.31 g/mol. Its IUPAC name is (6,8-diacetyloxy-9-oxoxanthen-3-yl) acetate.

Molecular Properties

Compound Name(6,8-diacetyloxy-9-oxoxanthen-3-yl) acetate
PubChem CID70687596
Molecular FormulaC19H14O8
Molecular Weight370.31 g/mol
Exact Mass370.07
IUPAC Name(6,8-diacetyloxy-9-oxoxanthen-3-yl) acetate
SMILESCC(=O)Oc1ccc2c(=O)c3c(OC(C)=O)cc(OC(C)=O)cc3oc2c1
InChIInChI=1S/C19H14O8/c1-9(20)24-12-4-5-14-15(6-12)27-17-8-13(25-10(2)21)7-16(26-11(3)22)18(17)19(14)23/h4-8H,1-3H3
InChIKeyADQSTMGPNSJMME-UHFFFAOYSA-N
XLogP2.72
TPSA109.11 Ų
H-Bond Donors
H-Bond Acceptors8
Rotatable Bonds3
Heavy Atoms27
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500370.31
LogP ≤ 52.72
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}

Analyze (6,8-diacetyloxy-9-oxoxanthen-3-yl) acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (6,8-diacetyloxy-9-oxoxanthen-3-yl) acetate?
The IUPAC name of (6,8-diacetyloxy-9-oxoxanthen-3-yl) acetate (CID 70687596) is (6,8-diacetyloxy-9-oxoxanthen-3-yl) acetate.
What is the SMILES notation for (6,8-diacetyloxy-9-oxoxanthen-3-yl) acetate?
The canonical SMILES for (6,8-diacetyloxy-9-oxoxanthen-3-yl) acetate is CC(=O)Oc1ccc2c(=O)c3c(OC(C)=O)cc(OC(C)=O)cc3oc2c1.
What is the InChIKey of (6,8-diacetyloxy-9-oxoxanthen-3-yl) acetate?
The InChIKey is ADQSTMGPNSJMME-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14O8/c1-9(20)24-12-4-5-14-15(6-12)27-17-8-13(25-10(2)21)7-16(26-11(3)22)18(17)19(14)23/h4-8H,1-3H3.
What are the key properties of (6,8-diacetyloxy-9-oxoxanthen-3-yl) acetate?
(6,8-diacetyloxy-9-oxoxanthen-3-yl) acetate has a molecular weight of 370.31 g/mol, XLogP of 2.72, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (6,8-diacetyloxy-9-oxoxanthen-3-yl) acetate is sourced from PubChem (CID 70687596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).