C19H14O8 — CID 70687596
(6,8-diacetyloxy-9-oxoxanthen-3-yl) acetate (PubChem CID 70687596) has the molecular formula C19H14O8 and a molecular weight of 370.31 g/mol. Its IUPAC name is (6,8-diacetyloxy-9-oxoxanthen-3-yl) acetate.
| Compound Name | (6,8-diacetyloxy-9-oxoxanthen-3-yl) acetate |
|---|---|
| PubChem CID | 70687596 |
| Molecular Formula | C19H14O8 |
| Molecular Weight | 370.31 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | (6,8-diacetyloxy-9-oxoxanthen-3-yl) acetate |
| SMILES | CC(=O)Oc1ccc2c(=O)c3c(OC(C)=O)cc(OC(C)=O)cc3oc2c1 |
| InChI | InChI=1S/C19H14O8/c1-9(20)24-12-4-5-14-15(6-12)27-17-8-13(25-10(2)21)7-16(26-11(3)22)18(17)19(14)23/h4-8H,1-3H3 |
| InChIKey | ADQSTMGPNSJMME-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 109.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|