C21H20O10 — CID 71326107
(6-acetyloxy-3,5,7,8-tetramethoxy-9-oxoxanthen-1-yl) acetate (PubChem CID 71326107) has the molecular formula C21H20O10 and a molecular weight of 432.38 g/mol. Its IUPAC name is (6-acetyloxy-3,5,7,8-tetramethoxy-9-oxoxanthen-1-yl) acetate.
| Compound Name | (6-acetyloxy-3,5,7,8-tetramethoxy-9-oxoxanthen-1-yl) acetate |
|---|---|
| PubChem CID | 71326107 |
| Molecular Formula | C21H20O10 |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | (6-acetyloxy-3,5,7,8-tetramethoxy-9-oxoxanthen-1-yl) acetate |
| SMILES | COc1cc(OC(C)=O)c2c(=O)c3c(OC)c(OC)c(OC(C)=O)c(OC)c3oc2c1 |
| InChI | InChI=1S/C21H20O10/c1-9(22)29-12-7-11(25-3)8-13-14(12)16(24)15-17(26-4)19(27-5)21(30-10(2)23)20(28-6)18(15)31-13/h7-8H,1-6H3 |
| InChIKey | WCKKYUKUPQJVND-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 119.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|