C10H7ClO4 — CID 11379152
4-(chloromethyl)-5,7-dihydroxychromen-2-one (PubChem CID 11379152) has the molecular formula C10H7ClO4 and a molecular weight of 226.61 g/mol. Its IUPAC name is 4-(chloromethyl)-5,7-dihydroxychromen-2-one.
| Compound Name | 4-(chloromethyl)-5,7-dihydroxychromen-2-one |
|---|---|
| PubChem CID | 11379152 |
| Molecular Formula | C10H7ClO4 |
| Molecular Weight | 226.61 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 4-(chloromethyl)-5,7-dihydroxychromen-2-one |
| SMILES | O=c1cc(CCl)c2c(O)cc(O)cc2o1 |
| InChI | InChI=1S/C10H7ClO4/c11-4-5-1-9(14)15-8-3-6(12)2-7(13)10(5)8/h1-3,12-13H,4H2 |
| InChIKey | SMMCGQQUJPNVBJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.61 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|